cas: 1214373-54-2 — see every product listed under this CAS number, including other names
2-NITRO-5-TRIFLUOROMETHYLBENZOIC ACID, 98% (CAS 1214373-54-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F334181-100MG |
| cas | 1214373-54-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 346.77 Pln | |
| Fluorochem | 250mg | 539.41 Pln | |
| Fluorochem | 1g | 997.58 Pln | |
| Fluorochem | 5g | 2887.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-nitro-5-(trifluoromethyl)benzoic acid (CAS 1214373-54-2) is a chemical compound with the molecular formula C8H4F3NO4 and a molecular weight of 235.12 g/mol. IUPAC name: 2-nitro-5-(trifluoromethyl)benzoic acid. InChIKey: POSKCQXWHNDYKW-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO4 |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | 2-nitro-5-(trifluoromethyl)benzoic acid |
| InChIKey | POSKCQXWHNDYKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)