Products 320-38-7
CAS 320-38-7 appears in our catalog under these names: 4–Nitro–3–(trifluoromethyl)benzoic acid, 4-Nitro-3-(trifluoromethyl)benzoic acid 98%, 4-nitro-3-(trifluoromethyl)benzoic acid, 98%, 98%, 4-Nitro-3-(trifluoromethyl)benzoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
4-nitro-3-(trifluoromethyl)benzoic acid (CAS 320-38-7) is a chemical compound with the molecular formula C8H4F3NO4 and a molecular weight of 235.12 g/mol. IUPAC name: 4-nitro-3-(trifluoromethyl)benzoic acid. InChIKey: JIQCKYQIVYCTEZ-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO4 |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | 4-nitro-3-(trifluoromethyl)benzoic acid |
| InChIKey | JIQCKYQIVYCTEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)