CAS 1214385-94-0 is the registry number for 2-Nitro-4-(trifluoromethoxy)benzaldehyde, 98%. Offered by: AmBeed. Available pack sizes: 5g.
2-nitro-4-(trifluoromethoxy)benzaldehyde (CAS 1214385-94-0) is a chemical compound with the molecular formula C8H4F3NO4 and a molecular weight of 235.12 g/mol. IUPAC name: 2-nitro-4-(trifluoromethoxy)benzaldehyde. InChIKey: GMDAHTTYCPZBOH-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO4 |
|---|---|
| Molecular weight | 235.12 g/mol |
| IUPAC name | 2-nitro-4-(trifluoromethoxy)benzaldehyde |
| InChIKey | GMDAHTTYCPZBOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)