cas: 21617-18-5 — see every product listed under this CAS number, including other names
4,5-Dichloroquinoline, 95% (CAS 21617-18-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237460-100MG |
| cas | 21617-18-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 638.33 Pln | |
| Fluorochem | 5g | 2970.85 Pln | |
| Fluorochem | 10g | 5402.28 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4,5-dichloroquinoline (CAS 21617-18-5) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 4,5-dichloroquinoline. InChIKey: SNZMBGPVGUVXRP-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 4,5-dichloroquinoline |
| InChIKey | SNZMBGPVGUVXRP-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CC(=C2C(=C1)Cl)Cl |
Computed by PubChem (NCBI)