cas: 21617-18-5 — see every product listed under this CAS number, including other names
4,5-Dichloroquinoline, 98%, 98% (CAS 21617-18-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149VY-50mg |
| cas | 21617-18-5 |
| size | 50mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 98.00 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 443.60 Pln | |
| Chemat | 5g | 1946.00 Pln | |
| Chemat | 10g | 3808.40 Pln | |
| Chemat | 25g | 9395.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,5-dichloroquinoline (CAS 21617-18-5) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 4,5-dichloroquinoline. InChIKey: SNZMBGPVGUVXRP-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 4,5-dichloroquinoline |
| InChIKey | SNZMBGPVGUVXRP-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CC(=C2C(=C1)Cl)Cl |
Computed by PubChem (NCBI)