cas: 66176-39-4 — see every product listed under this CAS number, including other names
4-(Bromomethyl)benzenesulfonyl chloride 98% (CAS 66176-39-4) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A657725-500g |
| cas | 66176-39-4 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 5582.44 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 464.94 Pln | |
| Ambeed | 100g | 1449.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A657725 |
4-(bromomethyl)benzenesulfonyl chloride (CAS 66176-39-4) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 4-(bromomethyl)benzenesulfonyl chloride. InChIKey: QXTQWYZHHMQSQH-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 4-(bromomethyl)benzenesulfonyl chloride |
| InChIKey | QXTQWYZHHMQSQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)S(=O)(=O)Cl |
Computed by PubChem (NCBI)