cas: 122839-52-5 — see every product listed under this CAS number, including other names
4-Fluoro-D-phenylalanine hydrochloride, 98% (CAS 122839-52-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03200-250MG |
| cas | 122839-52-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 737.26 Pln | |
| Fluorochem | 25g | 2658.46 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-amino-3-(4-fluorophenyl)propanoic acid;hydrochloride (CAS 122839-52-5) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: (2R)-2-amino-3-(4-fluorophenyl)propanoic acid;hydrochloride. InChIKey: ZDECBCKSULAIGP-DDWIOCJRSA-N.
| Molecular formula | C9H11ClFNO2 |
|---|---|
| Molecular weight | 219.64 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-fluorophenyl)propanoic acid;hydrochloride |
| InChIKey | ZDECBCKSULAIGP-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)N)F.Cl |
Computed by PubChem (NCBI)