cas: 26893-22-1 — see every product listed under this CAS number, including other names
4-Hydroxy-6,7-dimethoxyquinoline-3-carboxylic acid, 97% (CAS 26893-22-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A904996-5g |
| cas | 26893-22-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11495.05 Pln | |
| AmBeed | 10g | 17842.30 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
6,7-dimethoxy-4-oxo-1H-quinoline-3-carboxylic acid (CAS 26893-22-1) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 6,7-dimethoxy-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: OHEYCDPOWKNXLX-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 6,7-dimethoxy-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | OHEYCDPOWKNXLX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C(=CN2)C(=O)O)OC |
Computed by PubChem (NCBI)