cas: 26893-22-1 — see every product listed under this CAS number, including other names
4-Hydroxy-6,7-dimethoxyquinoline-3-carboxylic acid, 98%, 98% (CAS 26893-22-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BFKX-250mg |
| cas | 26893-22-1 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 856.40 Pln | |
| Chemat | 1g | 1653.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6,7-dimethoxy-4-oxo-1H-quinoline-3-carboxylic acid (CAS 26893-22-1) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 6,7-dimethoxy-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: OHEYCDPOWKNXLX-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 6,7-dimethoxy-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | OHEYCDPOWKNXLX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C(=CN2)C(=O)O)OC |
Computed by PubChem (NCBI)