5-Chlorothieno[3,2-b]pyridine-3-carboxylic acid, 95%
cas: 1356016-34-6 — see every product listed under this CAS number, including other names
5-Chlorothieno[3,2-b]pyridine-3-carboxylic acid, 95% (CAS 1356016-34-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A391391-250mg |
| cas | 1356016-34-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1749.88 Pln | |
| Ambeed | 1g | 4592.31 Pln | |
| Chemat | 50mg | 539.60 Pln | |
| Chemat | 100mg | 870.80 Pln | |
| Chemat | 250mg | 1682.00 Pln | |
| Chemat | 1g | 4912.40 Pln | |
| BLDpharm | 50mg | 697.56 Pln | |
| BLDpharm | 100mg | 1136.29 Pln | |
| BLDpharm | 250mg | 1880.47 Pln | |
| BLDpharm | 1g | 4946.06 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-chlorothieno[3,2-b]pyridine-3-carboxylic acid (CAS 1356016-34-6) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 5-chlorothieno[3,2-b]pyridine-3-carboxylic acid. InChIKey: DHMWTHARWQKMLE-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 5-chlorothieno[3,2-b]pyridine-3-carboxylic acid |
| InChIKey | DHMWTHARWQKMLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1SC=C2C(=O)O)Cl |
Computed by PubChem (NCBI)