CAS 1360891-68-4 is the registry number for 4-Chlorothieno[3,2-c]pyridine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-chlorothieno[3,2-c]pyridine-2-carboxylic acid (CAS 1360891-68-4) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 4-chlorothieno[3,2-c]pyridine-2-carboxylic acid. InChIKey: LVZKJIOAGUOVHK-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 4-chlorothieno[3,2-c]pyridine-2-carboxylic acid |
| InChIKey | LVZKJIOAGUOVHK-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1SC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)