CAS 155559-77-6 appears in our catalog under these names: 6-Chloro[1,3]dioxolo[4,5-f][1,3]benzothiazole, 95%, 6-Chloro-(1,3)dioxolo(4',5':4,5)benzo(1,2-d)thiazole, 95+%, 11-Chloro-4,6-dioxa-10-thia-12-azatricyclo(7.3.0.0,3,7)dodeca-1,3(7),8,11-tetraene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 50mg, 0,5g.
6-chloro-[1,3]dioxolo[4,5-f][1,3]benzothiazole (CAS 155559-77-6) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 6-chloro-[1,3]dioxolo[4,5-f][1,3]benzothiazole. InChIKey: WZRZVJFFQLMHCP-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 6-chloro-[1,3]dioxolo[4,5-f][1,3]benzothiazole |
| InChIKey | WZRZVJFFQLMHCP-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)N=C(S3)Cl |
Computed by PubChem (NCBI)