Products 3622-03-5
CAS 3622-03-5 appears in our catalog under these names: 6-Chlorobenzo[d]thiazole-2-carboxylic acid, 95%, 6-Chlorobenzo(d)thiazole-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
6-chloro-1,3-benzothiazole-2-carboxylic acid (CAS 3622-03-5) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 6-chloro-1,3-benzothiazole-2-carboxylic acid. InChIKey: FXZTXJYJMOJSBU-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 6-chloro-1,3-benzothiazole-2-carboxylic acid |
| InChIKey | FXZTXJYJMOJSBU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)SC(=N2)C(=O)O |
Computed by PubChem (NCBI)