CAS 700844-19-5 is the registry number for 4-Chlorothieno[2,3-b]pyridine-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chlorothieno[2,3-b]pyridine-5-carboxylic acid (CAS 700844-19-5) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 4-chlorothieno[2,3-b]pyridine-5-carboxylic acid. InChIKey: SRFCCWMMWYCDSK-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 4-chlorothieno[2,3-b]pyridine-5-carboxylic acid |
| InChIKey | SRFCCWMMWYCDSK-UHFFFAOYSA-N |
| SMILES | C1=CSC2=NC=C(C(=C21)Cl)C(=O)O |
Computed by PubChem (NCBI)