Products 700844-19-5

CAS 700844-19-5 is the registry number for 4-Chlorothieno[2,3-b]pyridine-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

4-chlorothieno[2,3-b]pyridine-5-carboxylic acid (CAS 700844-19-5) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 4-chlorothieno[2,3-b]pyridine-5-carboxylic acid. InChIKey: SRFCCWMMWYCDSK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4ClNO2S
Molecular weight213.64 g/mol
IUPAC name4-chlorothieno[2,3-b]pyridine-5-carboxylic acid
InChIKeySRFCCWMMWYCDSK-UHFFFAOYSA-N
SMILESC1=CSC2=NC=C(C(=C21)Cl)C(=O)O

Computed by PubChem (NCBI)