Products 3507-53-7
CAS 3507-53-7 appears in our catalog under these names: Sodium 5-chlorobenzo[d]thiazole-2-carboxylate, 95%, 5–Chlorobenzo(d)thiazole–2–carboxylic acid, 5-Chlorobenzo[d]thiazole-2-carboxylic acid 95%, 5-Chlorobenzo[d]thiazole-2-carboxylic acid, 95%, 95%, 5-Chloro-1,3-benzothiazole-2-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
5-chloro-1,3-benzothiazole-2-carboxylic acid (CAS 3507-53-7) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 5-chloro-1,3-benzothiazole-2-carboxylic acid. InChIKey: TZCPBIKLIIUHTD-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 5-chloro-1,3-benzothiazole-2-carboxylic acid |
| InChIKey | TZCPBIKLIIUHTD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=C(S2)C(=O)O |
Computed by PubChem (NCBI)