Products 251996-86-8
CAS 251996-86-8 appears in our catalog under these names: 4-Chlorothieno[2,3-c]pyridine-2-carboxylic acid, 95%, 4-trifluoromethyl-2-hydroxy-pyrimidine-5-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 0,25g.
4-chlorothieno[2,3-c]pyridine-2-carboxylic acid (CAS 251996-86-8) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 4-chlorothieno[2,3-c]pyridine-2-carboxylic acid. InChIKey: LLXSBUMTRUIFAL-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 4-chlorothieno[2,3-c]pyridine-2-carboxylic acid |
| InChIKey | LLXSBUMTRUIFAL-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=CN=CC(=C21)Cl)C(=O)O |
Computed by PubChem (NCBI)