CAS 1356016-34-6 appears in our catalog under these names: 5-Chlorothieno[3,2-b]pyridine-3-carboxylic acid, 95%, 95%, 5-Chlorothieno[3,2-b]pyridine-3-carboxylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-chlorothieno[3,2-b]pyridine-3-carboxylic acid (CAS 1356016-34-6) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 5-chlorothieno[3,2-b]pyridine-3-carboxylic acid. InChIKey: DHMWTHARWQKMLE-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 5-chlorothieno[3,2-b]pyridine-3-carboxylic acid |
| InChIKey | DHMWTHARWQKMLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1SC=C2C(=O)O)Cl |
Computed by PubChem (NCBI)