CAS 1354932-86-7 is the registry number for 5-Chloro-3-(thiophen-2-yl)isoxazole-4-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-thiophen-2-yl-1,2-oxazole-4-carbaldehyde (CAS 1354932-86-7) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 5-chloro-3-thiophen-2-yl-1,2-oxazole-4-carbaldehyde. InChIKey: UWODAJUJLBHVQP-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 5-chloro-3-thiophen-2-yl-1,2-oxazole-4-carbaldehyde |
| InChIKey | UWODAJUJLBHVQP-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NOC(=C2C=O)Cl |
Computed by PubChem (NCBI)