Products 1393576-38-9
CAS 1393576-38-9 appears in our catalog under these names: 2-Chlorobenzo(d)thiazole-5-carboxylic acid, 95%, 2–Chlorobenzo(d)thiazole–5–carboxylic acid, 2-Chlorobenzo[d]thiazole-5-carboxylic acid, 99%, 99%, 2-CHLOROBENZO[D]THIAZOLE-5-CARBOXYLIC ACID, 95%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 1g, 250mg, 500mg.
2-chloro-1,3-benzothiazole-5-carboxylic acid (CAS 1393576-38-9) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 2-chloro-1,3-benzothiazole-5-carboxylic acid. InChIKey: USIYKVRPNWXYIR-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 2-chloro-1,3-benzothiazole-5-carboxylic acid |
| InChIKey | USIYKVRPNWXYIR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)N=C(S2)Cl |
Computed by PubChem (NCBI)