CAS 937640-24-9 appears in our catalog under these names: 3-Chlorothieno[2,3-b]pyridine-2-carboxylic acid, 95%, 3-Chlorothieno(2,3-b)pyridine-2-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 50mg.
3-chlorothieno[2,3-b]pyridine-2-carboxylic acid (CAS 937640-24-9) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 3-chlorothieno[2,3-b]pyridine-2-carboxylic acid. InChIKey: UYYCHKKPKUVKIW-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 3-chlorothieno[2,3-b]pyridine-2-carboxylic acid |
| InChIKey | UYYCHKKPKUVKIW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)SC(=C2Cl)C(=O)O |
Computed by PubChem (NCBI)