Products 90690-94-1
CAS 90690-94-1 appears in our catalog under these names: 7-Chlorothieno[3,2-b]pyridine-6-carboxylic acid, 95%, 7-Chlorothieno(3,2-b)pyridine-6-carboxylic Acid, 7-CHLOROTHIENO[3,2-B]PYRIDINE-6-CARBOXYLIC ACID, 98%, 98%, 7-Chlorothieno[3,2-b]pyridine-6-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 0,5g, 100mg.
7-chlorothieno[3,2-b]pyridine-6-carboxylic acid (CAS 90690-94-1) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 7-chlorothieno[3,2-b]pyridine-6-carboxylic acid. InChIKey: DTWMSCLROSNKBA-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 7-chlorothieno[3,2-b]pyridine-6-carboxylic acid |
| InChIKey | DTWMSCLROSNKBA-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C(C(=CN=C21)C(=O)O)Cl |
Computed by PubChem (NCBI)