6-Chlorothieno[3,2-c]pyridine-2-carboxylic acid, 98%
cas: 2095607-18-2 — see every product listed under this CAS number, including other names
6-Chlorothieno[3,2-c]pyridine-2-carboxylic acid, 98% (CAS 2095607-18-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1690456-100mg |
| cas | 2095607-18-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 464.94 Pln | |
| Ambeed | 250mg | 748.62 Pln | |
| Ambeed | 1g | 1872.25 Pln | |
| BLDpharm | 100mg | 458.75 Pln | |
| BLDpharm | 250mg | 730.88 Pln | |
| BLDpharm | 1g | 1836.04 Pln | |
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 1374.80 Pln | |
| Fluorochem | 1g | 1773.35 Pln | |
| Fluorochem | 250mg | 716.43 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
6-chlorothieno[3,2-c]pyridine-2-carboxylic acid (CAS 2095607-18-2) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 6-chlorothieno[3,2-c]pyridine-2-carboxylic acid. InChIKey: PLVRHJKTBBGUQI-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 6-chlorothieno[3,2-c]pyridine-2-carboxylic acid |
| InChIKey | PLVRHJKTBBGUQI-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=C1Cl)C=C(S2)C(=O)O |
Computed by PubChem (NCBI)