Products 2095607-18-2
CAS 2095607-18-2 appears in our catalog under these names: 6-Chlorothieno[3,2-c]pyridine-2-carboxylic acid, 98%, 98%, 6-Chlorothieno[3,2-c]pyridine-2-carboxylic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
6-chlorothieno[3,2-c]pyridine-2-carboxylic acid (CAS 2095607-18-2) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 6-chlorothieno[3,2-c]pyridine-2-carboxylic acid. InChIKey: PLVRHJKTBBGUQI-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 6-chlorothieno[3,2-c]pyridine-2-carboxylic acid |
| InChIKey | PLVRHJKTBBGUQI-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=C1Cl)C=C(S2)C(=O)O |
Computed by PubChem (NCBI)