cas: 42718-18-3 — see every product listed under this CAS number, including other names
Benzeneacetic acid, α-amino-4-fluoro-, methyl ester, hydrochloride (1:1), 97%, 97% (CAS 42718-18-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CN2B-1g |
| cas | 42718-18-3 |
| size | 1g |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 798.80 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 122.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-amino-2-(4-fluorophenyl)acetate;hydrochloride (CAS 42718-18-3) is a chemical compound with the molecular formula C9H11ClFNO2 and a molecular weight of 219.64 g/mol. IUPAC name: methyl 2-amino-2-(4-fluorophenyl)acetate;hydrochloride. InChIKey: JLGSKYIBZLQSFR-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNO2 |
|---|---|
| Molecular weight | 219.64 g/mol |
| IUPAC name | methyl 2-amino-2-(4-fluorophenyl)acetate;hydrochloride |
| InChIKey | JLGSKYIBZLQSFR-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)