cas: 38678-58-9 — see every product listed under this CAS number, including other names
Phenoxyacetic acid N-hydroxysuccinimide ester, 95%, 95% (CAS 38678-58-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TOF-1g |
| cas | 38678-58-9 |
| size | 1g |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 500mg | 126.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 2-phenoxyacetate (CAS 38678-58-9) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-phenoxyacetate. InChIKey: SMBVSRKAVRAVKU-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-phenoxyacetate |
| InChIKey | SMBVSRKAVRAVKU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)COC2=CC=CC=C2 |
Computed by PubChem (NCBI)