cas: 38678-58-9 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 2-phenoxyacetate, 95% (CAS 38678-58-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F869008-25G |
| cas | 38678-58-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 1237.08 Pln | |
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 10g | 737.26 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 2-phenoxyacetate (CAS 38678-58-9) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-phenoxyacetate. InChIKey: SMBVSRKAVRAVKU-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-phenoxyacetate |
| InChIKey | SMBVSRKAVRAVKU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)COC2=CC=CC=C2 |
Computed by PubChem (NCBI)