CAS 1027512-49-7 is the registry number for 3-Carboxy-4-chlorophenylisothiocyanate, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g.
2-chloro-5-isothiocyanatobenzoic acid (CAS 1027512-49-7) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 2-chloro-5-isothiocyanatobenzoic acid. InChIKey: XERCHXQQJWIKTK-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 2-chloro-5-isothiocyanatobenzoic acid |
| InChIKey | XERCHXQQJWIKTK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C=S)C(=O)O)Cl |
Computed by PubChem (NCBI)