CAS 1052550-21-6 is the registry number for [(1,1-Dioxidotetrahydrothien-3-yl)(methyl)amino]acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-[(1,1-dioxothiolan-3-yl)-methylamino]acetic acid;hydrochloride (CAS 1052550-21-6) is a chemical compound with the molecular formula C7H14ClNO4S and a molecular weight of 243.71 g/mol. IUPAC name: 2-[(1,1-dioxothiolan-3-yl)-methylamino]acetic acid;hydrochloride. InChIKey: DMGUNPNZWWFMCY-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO4S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]acetic acid;hydrochloride |
| InChIKey | DMGUNPNZWWFMCY-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C1CCS(=O)(=O)C1.Cl |
Computed by PubChem (NCBI)