Products 2551115-06-9

CAS 2551115-06-9 is the registry number for Methyl 2-(3-amino-1,1-dioxidotetrahydrothiophen-3-yl)acetate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(3-amino-1,1-dioxothiolan-3-yl)acetate;hydrochloride (CAS 2551115-06-9) is a chemical compound with the molecular formula C7H14ClNO4S and a molecular weight of 243.71 g/mol. IUPAC name: methyl 2-(3-amino-1,1-dioxothiolan-3-yl)acetate;hydrochloride. InChIKey: AQOVUXRXADKHHG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO4S
Molecular weight243.71 g/mol
IUPAC namemethyl 2-(3-amino-1,1-dioxothiolan-3-yl)acetate;hydrochloride
InChIKeyAQOVUXRXADKHHG-UHFFFAOYSA-N
SMILESCOC(=O)CC1(CCS(=O)(=O)C1)N.Cl

Computed by PubChem (NCBI)