CAS 2551115-06-9 is the registry number for Methyl 2-(3-amino-1,1-dioxidotetrahydrothiophen-3-yl)acetate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 2-(3-amino-1,1-dioxothiolan-3-yl)acetate;hydrochloride (CAS 2551115-06-9) is a chemical compound with the molecular formula C7H14ClNO4S and a molecular weight of 243.71 g/mol. IUPAC name: methyl 2-(3-amino-1,1-dioxothiolan-3-yl)acetate;hydrochloride. InChIKey: AQOVUXRXADKHHG-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO4S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | methyl 2-(3-amino-1,1-dioxothiolan-3-yl)acetate;hydrochloride |
| InChIKey | AQOVUXRXADKHHG-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1(CCS(=O)(=O)C1)N.Cl |
Computed by PubChem (NCBI)