CAS 2940879-53-6 appears in our catalog under these names: (R)-2-Amino-2-(1,1-dioxidotetrahydro-2H-thiopyran-4-yl)acetic acid hydrochloride, 98%, (2R)-2-amino-2-(1,1-dioxothian-4-yl)acetic acid,hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
(2R)-2-amino-2-(1,1-dioxothian-4-yl)acetic acid;hydrochloride (CAS 2940879-53-6) is a chemical compound with the molecular formula C7H14ClNO4S and a molecular weight of 243.71 g/mol. IUPAC name: (2R)-2-amino-2-(1,1-dioxothian-4-yl)acetic acid;hydrochloride. InChIKey: YIQQGUGIBCWLNA-FYZOBXCZSA-N.
| Molecular formula | C7H14ClNO4S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | (2R)-2-amino-2-(1,1-dioxothian-4-yl)acetic acid;hydrochloride |
| InChIKey | YIQQGUGIBCWLNA-FYZOBXCZSA-N |
| SMILES | C1CS(=O)(=O)CCC1[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)