CAS 1955540-32-5 appears in our catalog under these names: 2-(4-Methyl-1,1-dioxidothiomorpholin-3-yl)acetic acid hydrochloride, 95%, 2-(4-Methyl-1,1-dioxo-1λâ¶-thiomorpholin-3-yl)acetic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(4-methyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid;hydrochloride (CAS 1955540-32-5) is a chemical compound with the molecular formula C7H14ClNO4S and a molecular weight of 243.71 g/mol. IUPAC name: 2-(4-methyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid;hydrochloride. InChIKey: QOQPXHHVVRCDPS-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO4S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | 2-(4-methyl-1,1-dioxo-1,4-thiazinan-3-yl)acetic acid;hydrochloride |
| InChIKey | QOQPXHHVVRCDPS-UHFFFAOYSA-N |
| SMILES | CN1CCS(=O)(=O)CC1CC(=O)O.Cl |
Computed by PubChem (NCBI)