CAS 2243514-11-4 is the registry number for Ethyl 2-(3-amino-1,1-dioxo-1λâ¶-thietan-3-yl)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 2-(3-amino-1,1-dioxothietan-3-yl)acetate;hydrochloride (CAS 2243514-11-4) is a chemical compound with the molecular formula C7H14ClNO4S and a molecular weight of 243.71 g/mol. IUPAC name: ethyl 2-(3-amino-1,1-dioxothietan-3-yl)acetate;hydrochloride. InChIKey: FVPJXLKHHKZLGW-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO4S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | ethyl 2-(3-amino-1,1-dioxothietan-3-yl)acetate;hydrochloride |
| InChIKey | FVPJXLKHHKZLGW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1(CS(=O)(=O)C1)N.Cl |
Computed by PubChem (NCBI)