CAS 2138144-40-6 is the registry number for 2-(4-Amino-1,1-dioxo-1λâ¶-thian-4-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(4-amino-1,1-dioxothian-4-yl)acetic acid;hydrochloride (CAS 2138144-40-6) is a chemical compound with the molecular formula C7H14ClNO4S and a molecular weight of 243.71 g/mol. IUPAC name: 2-(4-amino-1,1-dioxothian-4-yl)acetic acid;hydrochloride. InChIKey: ADAXXSYRENOBDG-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO4S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | 2-(4-amino-1,1-dioxothian-4-yl)acetic acid;hydrochloride |
| InChIKey | ADAXXSYRENOBDG-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1(CC(=O)O)N.Cl |
Computed by PubChem (NCBI)