Products 2138144-40-6

CAS 2138144-40-6 is the registry number for 2-(4-Amino-1,1-dioxo-1λâ¶-thian-4-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(4-amino-1,1-dioxothian-4-yl)acetic acid;hydrochloride (CAS 2138144-40-6) is a chemical compound with the molecular formula C7H14ClNO4S and a molecular weight of 243.71 g/mol. IUPAC name: 2-(4-amino-1,1-dioxothian-4-yl)acetic acid;hydrochloride. InChIKey: ADAXXSYRENOBDG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO4S
Molecular weight243.71 g/mol
IUPAC name2-(4-amino-1,1-dioxothian-4-yl)acetic acid;hydrochloride
InChIKeyADAXXSYRENOBDG-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCC1(CC(=O)O)N.Cl

Computed by PubChem (NCBI)