CAS 2060037-69-4 appears in our catalog under these names: Methyl 2-(1,1-dioxidothiomorpholin-3-yl)acetate hydrochloride, 95%, Methyl 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetate;hydrochloride (CAS 2060037-69-4) is a chemical compound with the molecular formula C7H14ClNO4S and a molecular weight of 243.71 g/mol. IUPAC name: methyl 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetate;hydrochloride. InChIKey: DZKUXIVZGPWWMY-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO4S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | methyl 2-(1,1-dioxo-1,4-thiazinan-3-yl)acetate;hydrochloride |
| InChIKey | DZKUXIVZGPWWMY-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1CS(=O)(=O)CCN1.Cl |
Computed by PubChem (NCBI)