CAS 1909305-00-5 appears in our catalog under these names: Methyl 1,4-thiazepane-6-carboxylate 1,1-dioxide hydrochloride, 95%, Methyl 1,1-dioxo-1λâ¶,4-thiazepane-6-carboxylate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 1,1-dioxo-1,4-thiazepane-6-carboxylate;hydrochloride (CAS 1909305-00-5) is a chemical compound with the molecular formula C7H14ClNO4S and a molecular weight of 243.71 g/mol. IUPAC name: methyl 1,1-dioxo-1,4-thiazepane-6-carboxylate;hydrochloride. InChIKey: PFIAZMLRIULCCR-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO4S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | methyl 1,1-dioxo-1,4-thiazepane-6-carboxylate;hydrochloride |
| InChIKey | PFIAZMLRIULCCR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CNCCS(=O)(=O)C1.Cl |
Computed by PubChem (NCBI)