CAS 1177292-41-9 appears in our catalog under these names: Methyl [(1,1-dioxidotetrahydrothien-3-yl)amino]acetate hydrochloride, 95%, methyl ((1,1-dioxidotetrahydrothien-3-yl)amino)acetate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
Methyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate;hydrochloride (CAS 1177292-41-9) is a chemical compound with the molecular formula C7H14ClNO4S and a molecular weight of 243.71 g/mol. IUPAC name: methyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate;hydrochloride. InChIKey: DBHGPYWFOFFBNO-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO4S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | methyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate;hydrochloride |
| InChIKey | DBHGPYWFOFFBNO-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC1CCS(=O)(=O)C1.Cl |
Computed by PubChem (NCBI)