Products 2375248-23-8
CAS 2375248-23-8 is the registry number for Methyl (2S,4R)-4-methanesulfonylpyrrolidine-2-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl (2S,4R)-4-methylsulfonylpyrrolidine-2-carboxylate;hydrochloride (CAS 2375248-23-8) is a chemical compound with the molecular formula C7H14ClNO4S and a molecular weight of 243.71 g/mol. IUPAC name: methyl (2S,4R)-4-methylsulfonylpyrrolidine-2-carboxylate;hydrochloride. InChIKey: DHTLPAYZAHKVRB-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO4S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | methyl (2S,4R)-4-methylsulfonylpyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | DHTLPAYZAHKVRB-IBTYICNHSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1)S(=O)(=O)C.Cl |
Computed by PubChem (NCBI)