Products 2260933-24-0
CAS 2260933-24-0 is the registry number for 2-Amino-3-(1,1-dioxo-1λâ¶-thiolan-3-yl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-3-(1,1-dioxothiolan-3-yl)propanoic acid;hydrochloride (CAS 2260933-24-0) is a chemical compound with the molecular formula C7H14ClNO4S and a molecular weight of 243.71 g/mol. IUPAC name: 2-amino-3-(1,1-dioxothiolan-3-yl)propanoic acid;hydrochloride. InChIKey: BHKBDRJDJRVWTH-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO4S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | 2-amino-3-(1,1-dioxothiolan-3-yl)propanoic acid;hydrochloride |
| InChIKey | BHKBDRJDJRVWTH-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)