Products 108392-76-3

CAS 108392-76-3 appears in our catalog under these names: (R)-Amino-(4-chloro-phenyl)-acetic acid hydrochloride, 95%, (R)-2-Amino-2-(4-chlorophenyl)acetic acid hydrochloride, 97%, (R)-2-Amino-2-(4-chlorophenyl)acetic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

(2R)-2-amino-2-(4-chlorophenyl)acetic acid;hydrochloride (CAS 108392-76-3) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: (2R)-2-amino-2-(4-chlorophenyl)acetic acid;hydrochloride. InChIKey: VDZFBXOENJDFCO-OGFXRTJISA-N.

Identity
Molecular formulaC8H9Cl2NO2
Molecular weight222.07 g/mol
IUPAC name(2R)-2-amino-2-(4-chlorophenyl)acetic acid;hydrochloride
InChIKeyVDZFBXOENJDFCO-OGFXRTJISA-N
SMILESC1=CC(=CC=C1[C@H](C(=O)O)N)Cl.Cl

Computed by PubChem (NCBI)