CAS 1184843-27-3 is the registry number for 3,8-Dichloroisoquinoline, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3,8-dichloroisoquinoline (CAS 1184843-27-3) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 3,8-dichloroisoquinoline. InChIKey: MZTDDGSXLMDFKB-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 3,8-dichloroisoquinoline |
| InChIKey | MZTDDGSXLMDFKB-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=NC=C2C(=C1)Cl)Cl |
Computed by PubChem (NCBI)