CAS 1504563-06-7 is the registry number for 2,5-Dibromo-N-methoxy-N-methylbenzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2,5-dibromo-N-methoxy-N-methylbenzamide (CAS 1504563-06-7) is a chemical compound with the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. IUPAC name: 2,5-dibromo-N-methoxy-N-methylbenzamide. InChIKey: JUGYPRCHZHNGJG-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2NO2 |
|---|---|
| Molecular weight | 322.98 g/mol |
| IUPAC name | 2,5-dibromo-N-methoxy-N-methylbenzamide |
| InChIKey | JUGYPRCHZHNGJG-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=C(C=CC(=C1)Br)Br)OC |
Computed by PubChem (NCBI)