CAS 1240528-65-7 is the registry number for 2-(2,6-Dichlorophenyl)propan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2,6-dichlorophenyl)propan-2-amine;hydrochloride (CAS 1240528-65-7) is a chemical compound with the molecular formula C9H12Cl3N and a molecular weight of 240.6 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)propan-2-amine;hydrochloride. InChIKey: ANINNMQZKKXFBJ-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl3N |
|---|---|
| Molecular weight | 240.6 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)propan-2-amine;hydrochloride |
| InChIKey | ANINNMQZKKXFBJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=CC=C1Cl)Cl)N.Cl |
Computed by PubChem (NCBI)