Products 125398-17-6
CAS 125398-17-6 appears in our catalog under these names: Methyl 2-(chloromethyl)isonicotinate hydrochloride, 95%, Methyl 2-(chloromethyl)isonicotinate hydrochloride, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2-(chloromethyl)pyridine-4-carboxylate;hydrochloride (CAS 125398-17-6) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: methyl 2-(chloromethyl)pyridine-4-carboxylate;hydrochloride. InChIKey: ICQYKDMSIZPRPH-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | methyl 2-(chloromethyl)pyridine-4-carboxylate;hydrochloride |
| InChIKey | ICQYKDMSIZPRPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC=C1)CCl.Cl |
Computed by PubChem (NCBI)