CAS 23589-73-3 appears in our catalog under these names: 5-(3-Chlorophenyl)-2H-1,3,4-oxathiazol-2-one, 5-(3-Chlorophenyl)-2H-1,3,4-oxathiazol-2-one, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
5-(3-chlorophenyl)-1,3,4-oxathiazol-2-one (CAS 23589-73-3) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 5-(3-chlorophenyl)-1,3,4-oxathiazol-2-one. InChIKey: IBNXWVDYILLAKN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-1,3,4-oxathiazol-2-one |
| InChIKey | IBNXWVDYILLAKN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NSC(=O)O2 |
Computed by PubChem (NCBI)