Products 1379335-94-0
CAS 1379335-94-0 is the registry number for 4-Chlorothieno[2,3-b]pyridine-2-carboxylic acid, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
4-chlorothieno[2,3-b]pyridine-2-carboxylic acid (CAS 1379335-94-0) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 4-chlorothieno[2,3-b]pyridine-2-carboxylic acid. InChIKey: VGXKUAIWPFROEJ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 4-chlorothieno[2,3-b]pyridine-2-carboxylic acid |
| InChIKey | VGXKUAIWPFROEJ-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1Cl)C=C(S2)C(=O)O |
Computed by PubChem (NCBI)