Products 1379338-53-0
CAS 1379338-53-0 is the registry number for 3-Chlorothieno[2,3-c]pyridine-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-chlorothieno[2,3-c]pyridine-2-carboxylic acid (CAS 1379338-53-0) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 3-chlorothieno[2,3-c]pyridine-2-carboxylic acid. InChIKey: RIZPPLHGIQFTAP-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 3-chlorothieno[2,3-c]pyridine-2-carboxylic acid |
| InChIKey | RIZPPLHGIQFTAP-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=C(S2)C(=O)O)Cl |
Computed by PubChem (NCBI)