Products 1536794-94-1
CAS 1536794-94-1 appears in our catalog under these names: 6-Chlorothieno(2,3-b)pyridine-2-carboxylic acid, 95%, 6-chlorothieno[2,3-b]pyridine-2-carboxylic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g, 25g.
6-chlorothieno[2,3-b]pyridine-2-carboxylic acid (CAS 1536794-94-1) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 6-chlorothieno[2,3-b]pyridine-2-carboxylic acid. InChIKey: BJOOZLSQNAOOBN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 6-chlorothieno[2,3-b]pyridine-2-carboxylic acid |
| InChIKey | BJOOZLSQNAOOBN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C=C(S2)C(=O)O)Cl |
Computed by PubChem (NCBI)