Products 1594478-22-4
CAS 1594478-22-4 appears in our catalog under these names: 2-((5-(Thiophen-2-yl)isoxazol-3-yl)methoxy)acetic acid, 97%, 2-((5-(Thiophen-2-yl)isoxazol-3-yl)methoxy)acetic acid, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methoxy]acetic acid (CAS 1594478-22-4) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: 2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methoxy]acetic acid. InChIKey: IZOBQUKTOXLEAM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methoxy]acetic acid |
| InChIKey | IZOBQUKTOXLEAM-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=NO2)COCC(=O)O |
Computed by PubChem (NCBI)