CAS 1697221-90-1 is the registry number for 3,6-Dichloroisoquinoline, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3,6-dichloroisoquinoline (CAS 1697221-90-1) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 3,6-dichloroisoquinoline. InChIKey: WSZOXHNDDYCRLC-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 3,6-dichloroisoquinoline |
| InChIKey | WSZOXHNDDYCRLC-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=C(C=C2C=C1Cl)Cl |
Computed by PubChem (NCBI)