CAS 17452-79-8 is the registry number for 5–(4–Chlorophenyl)–1,3,4–oxathiazol–2–one. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
5-(4-chlorophenyl)-1,3,4-oxathiazol-2-one (CAS 17452-79-8) is a chemical compound with the molecular formula C8H4ClNO2S and a molecular weight of 213.64 g/mol. IUPAC name: 5-(4-chlorophenyl)-1,3,4-oxathiazol-2-one. InChIKey: FHAPVFFWHRPZFA-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2S |
|---|---|
| Molecular weight | 213.64 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1,3,4-oxathiazol-2-one |
| InChIKey | FHAPVFFWHRPZFA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NSC(=O)O2)Cl |
Computed by PubChem (NCBI)